C28H29N3O8 — CID 129072043
2-[2-(6-hexoxy-1-benzofuran-3-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioic acid (PubChem CID 129072043) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is 2-[2-(6-hexoxy-1-benzofuran-3-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioic acid.
| Compound Name | 2-[2-(6-hexoxy-1-benzofuran-3-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioic acid |
|---|---|
| PubChem CID | 129072043 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[2-(6-hexoxy-1-benzofuran-3-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioic acid |
| SMILES | CCCCCCOc1ccc2c(C(=O)CC(CCn3nnc4ccccc4c3=O)(C(=O)O)C(=O)O)coc2c1 |
| InChI | InChI=1S/C28H29N3O8/c1-2-3-4-7-14-38-18-10-11-19-21(17-39-24(19)15-18)23(32)16-28(26(34)35,27(36)37)12-13-31-25(33)20-8-5-6-9-22(20)29-30-31/h5-6,8-11,15,17H,2-4,7,12-14,16H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | AGOULQGSQPEHER-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|