C30H33N3O8 — CID 118585921
ditert-butyl 2-[2-(5-hydroxy-1-benzofuran-2-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate (PubChem CID 118585921) has the molecular formula C30H33N3O8 and a molecular weight of 563.61 g/mol. Its IUPAC name is ditert-butyl 2-[2-(5-hydroxy-1-benzofuran-2-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate.
| Compound Name | ditert-butyl 2-[2-(5-hydroxy-1-benzofuran-2-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 118585921 |
| Molecular Formula | C30H33N3O8 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | ditert-butyl 2-[2-(5-hydroxy-1-benzofuran-2-yl)-2-oxoethyl]-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCn1nnc2ccccc2c1=O)(CC(=O)c1cc2cc(O)ccc2o1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H33N3O8/c1-28(2,3)40-26(37)30(27(38)41-29(4,5)6,13-14-33-25(36)20-9-7-8-10-21(20)31-32-33)17-22(35)24-16-18-15-19(34)11-12-23(18)39-24/h7-12,15-16,34H,13-14,17H2,1-6H3 |
| InChIKey | PJYZMLVAQUOTEM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|