C36H39N3O8 — CID 118425938
ditert-butyl 2-[2-(4-benzoyloxyphenyl)-2-oxoethyl]-2-[2-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate (PubChem CID 118425938) has the molecular formula C36H39N3O8 and a molecular weight of 641.72 g/mol. Its IUPAC name is ditert-butyl 2-[2-(4-benzoyloxyphenyl)-2-oxoethyl]-2-[2-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate.
| Compound Name | ditert-butyl 2-[2-(4-benzoyloxyphenyl)-2-oxoethyl]-2-[2-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 118425938 |
| Molecular Formula | C36H39N3O8 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | ditert-butyl 2-[2-(4-benzoyloxyphenyl)-2-oxoethyl]-2-[2-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]propanedioate |
| SMILES | Cc1ccc2nnn(CCC(CC(=O)c3ccc(OC(=O)c4ccccc4)cc3)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C36H39N3O8/c1-23-13-18-28-27(21-23)30(41)39(38-37-28)20-19-36(32(43)46-34(2,3)4,33(44)47-35(5,6)7)22-29(40)24-14-16-26(17-15-24)45-31(42)25-11-9-8-10-12-25/h8-18,21H,19-20,22H2,1-7H3 |
| InChIKey | NFIHRFMBGPTDBM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 143.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|