C37H39N3O8 — CID 118585936
ditert-butyl 2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-2-[2-oxo-2-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]propanedioate (PubChem CID 118585936) has the molecular formula C37H39N3O8 and a molecular weight of 653.73 g/mol. Its IUPAC name is ditert-butyl 2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-2-[2-oxo-2-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]propanedioate.
| Compound Name | ditert-butyl 2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-2-[2-oxo-2-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 118585936 |
| Molecular Formula | C37H39N3O8 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | ditert-butyl 2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-2-[2-oxo-2-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCn1nnc2ccccc2c1=O)(CC(=O)c1cc2ccc(OCc3ccccc3)cc2o1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H39N3O8/c1-35(2,3)47-33(43)37(34(44)48-36(4,5)6,18-19-40-32(42)27-14-10-11-15-28(27)38-39-40)22-29(41)31-20-25-16-17-26(21-30(25)46-31)45-23-24-12-8-7-9-13-24/h7-17,20-21H,18-19,22-23H2,1-6H3 |
| InChIKey | SXJGKFRAKGNNHG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 139.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|