C28H31N3O5 — CID 123837689
2-[1-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethenyl]-5-(4-pentoxybenzoyl)cyclopentane-1-carboxylic acid (PubChem CID 123837689) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[1-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethenyl]-5-(4-pentoxybenzoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-[1-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethenyl]-5-(4-pentoxybenzoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 123837689 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[1-(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethenyl]-5-(4-pentoxybenzoyl)cyclopentane-1-carboxylic acid |
| SMILES | C=C(C1CCC(C(=O)c2ccc(OCCCCC)cc2)C1C(=O)O)n1nnc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C28H31N3O5/c1-4-5-6-15-36-20-10-8-19(9-11-20)26(32)22-13-12-21(25(22)28(34)35)18(3)31-27(33)23-16-17(2)7-14-24(23)29-30-31/h7-11,14,16,21-22,25H,3-6,12-13,15H2,1-2H3,(H,34,35) |
| InChIKey | QGWNBNHXAWDNNK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|