C33H45N3O5Si — CID 123832425
2-trimethylsilylethyl 2-(4-hexoxybenzoyl)-5-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate (PubChem CID 123832425) has the molecular formula C33H45N3O5Si and a molecular weight of 591.83 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-(4-hexoxybenzoyl)-5-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 2-(4-hexoxybenzoyl)-5-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 123832425 |
| Molecular Formula | C33H45N3O5Si |
| Molecular Weight | 591.83 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 2-trimethylsilylethyl 2-(4-hexoxybenzoyl)-5-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)C2CCC(Cn3nnc4ccc(C)cc4c3=O)C2C(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C33H45N3O5Si/c1-6-7-8-9-18-40-26-14-11-24(12-15-26)31(37)27-16-13-25(30(27)33(39)41-19-20-42(3,4)5)22-36-32(38)28-21-23(2)10-17-29(28)34-35-36/h10-12,14-15,17,21,25,27,30H,6-9,13,16,18-20,22H2,1-5H3 |
| InChIKey | DNIVIBSRSHULHH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.83 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|