C28H29F6N3O7S2 — CID 129073990
2-(trimethyl-λ4-sulfanyl)ethyl (1S,2R,5S)-2-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]-5-[4-(trifluoromethylsulfonyloxy)benzoyl]cyclopentane-1-carboxylate (PubChem CID 129073990) has the molecular formula C28H29F6N3O7S2 and a molecular weight of 697.68 g/mol. Its IUPAC name is 2-(trimethyl-λ4-sulfanyl)ethyl (1S,2R,5S)-2-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]-5-[4-(trifluoromethylsulfonyloxy)benzoyl]cyclopentane-1-carboxylate.
| Compound Name | 2-(trimethyl-λ4-sulfanyl)ethyl (1S,2R,5S)-2-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]-5-[4-(trifluoromethylsulfonyloxy)benzoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 129073990 |
| Molecular Formula | C28H29F6N3O7S2 |
| Molecular Weight | 697.68 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | 2-(trimethyl-λ4-sulfanyl)ethyl (1S,2R,5S)-2-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]-5-[4-(trifluoromethylsulfonyloxy)benzoyl]cyclopentane-1-carboxylate |
| SMILES | CS(C)(C)CCOC(=O)[C@H]1[C@H](Cn2nnc3ccc(C(F)(F)F)cc3c2=O)CC[C@@H]1C(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H29F6N3O7S2/c1-45(2,3)13-12-43-26(40)23-17(15-37-25(39)21-14-18(27(29,30)31)7-11-22(21)35-36-37)6-10-20(23)24(38)16-4-8-19(9-5-16)44-46(41,42)28(32,33)34/h4-5,7-9,11,14,17,20,23H,6,10,12-13,15H2,1-3H3/t17-,20-,23-/m0/s1 |
| InChIKey | AKSLCVLMIZCHTO-NYDSKATKSA-N |
| XLogP | 4.80 |
| TPSA | 134.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|