C8H14N4O2 — CID 103744237
1-ethyl-1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea (PubChem CID 103744237) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-ethyl-1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea.
| Compound Name | 1-ethyl-1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 103744237 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-ethyl-1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
| SMILES | CCN(C)C(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H14N4O2/c1-3-12(2)8(13)9-5-4-7-10-6-11-14-7/h6H,3-5H2,1-2H3,(H,9,13) |
| InChIKey | JPQLDRRIGJEFOK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |