C11H17F2NO — CID 103745513
3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-1,1-difluoropropan-2-ol (PubChem CID 103745513) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103745513 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-1,1-difluoropropan-2-ol |
| SMILES | OC(CNCC1CC2C=CC1C2)C(F)F |
| InChI | InChI=1S/C11H17F2NO/c12-11(13)10(15)6-14-5-9-4-7-1-2-8(9)3-7/h1-2,7-11,14-15H,3-6H2 |
| InChIKey | QJFJARFDIXXZCP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|