C10H17F2NO — CID 103838452
3-(cyclohex-3-en-1-ylmethylamino)-1,1-difluoropropan-2-ol (PubChem CID 103838452) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylamino)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylamino)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103838452 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylamino)-1,1-difluoropropan-2-ol |
| SMILES | OC(CNCC1CC=CCC1)C(F)F |
| InChI | InChI=1S/C10H17F2NO/c11-10(12)9(14)7-13-6-8-4-2-1-3-5-8/h1-2,8-10,13-14H,3-7H2 |
| InChIKey | QMKGHDBLGGQWBA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|