C14H15NO3S — CID 103749033
N-[(5-ethylthiophen-2-yl)methyl]-2,6-dihydroxybenzamide (PubChem CID 103749033) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-2,6-dihydroxybenzamide.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103749033 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-2,6-dihydroxybenzamide |
| SMILES | CCc1ccc(CNC(=O)c2c(O)cccc2O)s1 |
| InChI | InChI=1S/C14H15NO3S/c1-2-9-6-7-10(19-9)8-15-14(18)13-11(16)4-3-5-12(13)17/h3-7,16-17H,2,8H2,1H3,(H,15,18) |
| InChIKey | LDJGNRMCBZRVJA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |