About propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate
propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate (PubChem CID 10375131) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate.
Analyze propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate?
The IUPAC name of propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate (CID 10375131) is propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate.
What is the SMILES notation for propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate?
The canonical SMILES for propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate is CC(C)OC(=O)C1CCC(N)=NC1.
What is the InChIKey of propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate?
The InChIKey is JPUJNTRMOXCWAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-6(2)13-9(12)7-3-4-8(10)11-5-7/h6-7H,3-5H2,1-2H3,(H2,10,11).
What are the key properties of propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate?
propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate has a molecular weight of 184.24 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-amino-2,3,4,5-tetrahydropyridine-3-carboxylate is sourced from PubChem (CID 10375131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).