C9H14O3 — CID 142358356
propan-2-yl (1R,5S)-6-oxabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 142358356) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is propan-2-yl (1R,5S)-6-oxabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | propan-2-yl (1R,5S)-6-oxabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 142358356 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | propan-2-yl (1R,5S)-6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)OC(=O)C1C[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C9H14O3/c1-5(2)11-9(10)6-3-7-8(4-6)12-7/h5-8H,3-4H2,1-2H3/t6?,7-,8+ |
| InChIKey | XDBZHGOKTBBKRE-IEESLHIDSA-N |
| XLogP | 1.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|