C18H28O8S — CID 89266363
1-[1-(3-hydroxycyclohexanecarbonyl)oxyethylsulfonyl]ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 89266363) has the molecular formula C18H28O8S and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-[1-(3-hydroxycyclohexanecarbonyl)oxyethylsulfonyl]ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | 1-[1-(3-hydroxycyclohexanecarbonyl)oxyethylsulfonyl]ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 89266363 |
| Molecular Formula | C18H28O8S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[1-(3-hydroxycyclohexanecarbonyl)oxyethylsulfonyl]ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(OC(=O)C1CCCC(O)C1)S(=O)(=O)C(C)OC(=O)C1CCC2OC2C1 |
| InChI | InChI=1S/C18H28O8S/c1-10(24-17(20)12-4-3-5-14(19)8-12)27(22,23)11(2)25-18(21)13-6-7-15-16(9-13)26-15/h10-16,19H,3-9H2,1-2H3 |
| InChIKey | MDFYVSDIPQPKRN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|