C19H32O8S — CID 89208131
1-[1-[2-[(3-methyloxiran-2-yl)methyl]butanoyloxy]ethylsulfonyl]ethyl 3-hydroxycyclohexane-1-carboxylate (PubChem CID 89208131) has the molecular formula C19H32O8S and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-[1-[2-[(3-methyloxiran-2-yl)methyl]butanoyloxy]ethylsulfonyl]ethyl 3-hydroxycyclohexane-1-carboxylate.
| Compound Name | 1-[1-[2-[(3-methyloxiran-2-yl)methyl]butanoyloxy]ethylsulfonyl]ethyl 3-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89208131 |
| Molecular Formula | C19H32O8S |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[1-[2-[(3-methyloxiran-2-yl)methyl]butanoyloxy]ethylsulfonyl]ethyl 3-hydroxycyclohexane-1-carboxylate |
| SMILES | CCC(CC1OC1C)C(=O)OC(C)S(=O)(=O)C(C)OC(=O)C1CCCC(O)C1 |
| InChI | InChI=1S/C19H32O8S/c1-5-14(10-17-11(2)25-17)18(21)26-12(3)28(23,24)13(4)27-19(22)15-7-6-8-16(20)9-15/h11-17,20H,5-10H2,1-4H3 |
| InChIKey | IXMSSUBAYYEVLY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|