C24H44O5 — CID 91543007
1-ethoxyethyl 3-propan-2-ylcyclohexane-1-carboxylate;3-propan-2-ylcyclohexane-1-carboxylic acid (PubChem CID 91543007) has the molecular formula C24H44O5 and a molecular weight of 412.61 g/mol. Its IUPAC name is 1-ethoxyethyl 3-propan-2-ylcyclohexane-1-carboxylate;3-propan-2-ylcyclohexane-1-carboxylic acid.
| Compound Name | 1-ethoxyethyl 3-propan-2-ylcyclohexane-1-carboxylate;3-propan-2-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91543007 |
| Molecular Formula | C24H44O5 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | 1-ethoxyethyl 3-propan-2-ylcyclohexane-1-carboxylate;3-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES | CC(C)C1CCCC(C(=O)O)C1.CCOC(C)OC(=O)C1CCCC(C(C)C)C1 |
| InChI | InChI=1S/C14H26O3.C10H18O2/c1-5-16-11(4)17-14(15)13-8-6-7-12(9-13)10(2)3;1-7(2)8-4-3-5-9(6-8)10(11)12/h10-13H,5-9H2,1-4H3;7-9H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | SMJUFDOYGUGNEX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|