C25H46O4 — CID 141262281
3-heptadecan-8-yloxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 141262281) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is 3-heptadecan-8-yloxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 3-heptadecan-8-yloxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262281 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 3-heptadecan-8-yloxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCCCC(CCCCCCC)OC(=O)C1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C25H46O4/c1-3-5-7-9-10-12-14-19-23(18-13-11-8-6-4-2)29-25(28)22-17-15-16-21(20-22)24(26)27/h21-23H,3-20H2,1-2H3,(H,26,27) |
| InChIKey | DIWYOOJTXLERIT-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|