C24H44O4 — CID 141262299
3-(8-propyltridecan-6-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141262299) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 3-(8-propyltridecan-6-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(8-propyltridecan-6-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262299 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 3-(8-propyltridecan-6-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC(CCC)CC(CCCCC)OC(=O)C1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C24H44O4/c1-4-7-9-13-19(12-6-3)17-22(16-10-8-5-2)28-24(27)21-15-11-14-20(18-21)23(25)26/h19-22H,4-18H2,1-3H3,(H,25,26) |
| InChIKey | YHQFAKXKODVLGG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|