C25H44O6 — CID 174485104
cyclohexane-1,3-dicarboxylic acid;6-propylundecan-4-yl prop-2-enoate (PubChem CID 174485104) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is cyclohexane-1,3-dicarboxylic acid;6-propylundecan-4-yl prop-2-enoate.
| Compound Name | cyclohexane-1,3-dicarboxylic acid;6-propylundecan-4-yl prop-2-enoate |
|---|---|
| PubChem CID | 174485104 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | cyclohexane-1,3-dicarboxylic acid;6-propylundecan-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)CC(CCC)CCCCC.O=C(O)C1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C17H32O2.C8H12O4/c1-5-9-10-13-15(11-6-2)14-16(12-7-3)19-17(18)8-4;9-7(10)5-2-1-3-6(4-5)8(11)12/h8,15-16H,4-7,9-14H2,1-3H3;5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | MPSUKCUSVQYNNR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|