About (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone
(2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone (PubChem CID 103752604) has the molecular formula C12H15BrN2O2
and a molecular weight of 299.17 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone |
| PubChem CID | 103752604 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)COCCN1C(=O)c1cccnc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-12(2)8-17-7-6-15(12)11(16)9-4-3-5-14-10(9)13/h3-5H,6-8H2,1-2H3 |
| InChIKey | JHRLYSKUFDKCCF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone?
The IUPAC name of (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone (CID 103752604) is (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone?
The canonical SMILES for (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone is CC1(C)COCCN1C(=O)c1cccnc1Br.
What is the InChIKey of (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone?
The InChIKey is JHRLYSKUFDKCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O2/c1-12(2)8-17-7-6-15(12)11(16)9-4-3-5-14-10(9)13/h3-5H,6-8H2,1-2H3.
What are the key properties of (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone?
(2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone has a molecular weight of 299.17 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 103752604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).