C12H15BrN2O2 — CID 103752604
(2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone (PubChem CID 103752604) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone.
| Compound Name | (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 103752604 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2-bromo-3-pyridinyl)-(3,3-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)COCCN1C(=O)c1cccnc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-12(2)8-17-7-6-15(12)11(16)9-4-3-5-14-10(9)13/h3-5H,6-8H2,1-2H3 |
| InChIKey | JHRLYSKUFDKCCF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|