C14H19BrN2O — CID 103756009
(2-bromo-3-pyridinyl)-(3,3-diethylpyrrolidin-1-yl)methanone (PubChem CID 103756009) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl)-(3,3-diethylpyrrolidin-1-yl)methanone.
| Compound Name | (2-bromo-3-pyridinyl)-(3,3-diethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103756009 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (2-bromo-3-pyridinyl)-(3,3-diethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1(CC)CCN(C(=O)c2cccnc2Br)C1 |
| InChI | InChI=1S/C14H19BrN2O/c1-3-14(4-2)7-9-17(10-14)13(18)11-6-5-8-16-12(11)15/h5-6,8H,3-4,7,9-10H2,1-2H3 |
| InChIKey | VXOCWUAQBYUSHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|