C17H17BrN2O — CID 103754184
2-bromo-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide (PubChem CID 103754184) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103754184 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-bromo-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
| SMILES | CN(C(=O)c1ccnc(Br)c1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C17H17BrN2O/c1-20(17(21)13-9-10-19-16(18)11-13)15-8-4-6-12-5-2-3-7-14(12)15/h2-3,5,7,9-11,15H,4,6,8H2,1H3 |
| InChIKey | OXCZQQZXVNHUOM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|