C17H15BrClNO — CID 81295054
4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide (PubChem CID 81295054) has the molecular formula C17H15BrClNO and a molecular weight of 364.67 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide.
| Compound Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 81295054 |
| Molecular Formula | C17H15BrClNO |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Br)c(Cl)c1)C1CCc2ccccc21 |
| InChI | InChI=1S/C17H15BrClNO/c1-20(16-9-7-11-4-2-3-5-13(11)16)17(21)12-6-8-14(18)15(19)10-12/h2-6,8,10,16H,7,9H2,1H3 |
| InChIKey | XSNVAOLVLWNUKN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |