C18H18ClNO — CID 43578962
3-(chloromethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide (PubChem CID 43578962) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide.
| Compound Name | 3-(chloromethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 43578962 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-(chloromethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(CCl)c1)C1CCc2ccccc21 |
| InChI | InChI=1S/C18H18ClNO/c1-20(17-10-9-14-6-2-3-8-16(14)17)18(21)15-7-4-5-13(11-15)12-19/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | NZMMJWRZTKDPOJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|