C19H17N3O2S — CID 51128284
N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 51128284) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 51128284 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(=O)[nH]c(=S)[nH]c2c1)C1CCc2ccccc21 |
| InChI | InChI=1S/C19H17N3O2S/c1-22(16-9-7-11-4-2-3-5-13(11)16)18(24)12-6-8-14-15(10-12)20-19(25)21-17(14)23/h2-6,8,10,16H,7,9H2,1H3,(H2,20,21,23,25) |
| InChIKey | OJGVURDWRJIPGW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|