About 4-phenyl-1,3-oxathiolane-2-thione
4-phenyl-1,3-oxathiolane-2-thione (PubChem CID 10375443) has the molecular formula C9H8OS2
and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-phenyl-1,3-oxathiolane-2-thione.
Molecular Properties
| Compound Name | 4-phenyl-1,3-oxathiolane-2-thione |
| PubChem CID | 10375443 |
| Molecular Formula | C9H8OS2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 4-phenyl-1,3-oxathiolane-2-thione |
| SMILES | S=C1OCC(c2ccccc2)S1 |
| InChI | InChI=1S/C9H8OS2/c11-9-10-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | JTFNGUVZLCTGFU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-1,3-oxathiolane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,3-oxathiolane-2-thione?
The IUPAC name of 4-phenyl-1,3-oxathiolane-2-thione (CID 10375443) is 4-phenyl-1,3-oxathiolane-2-thione.
What is the SMILES notation for 4-phenyl-1,3-oxathiolane-2-thione?
The canonical SMILES for 4-phenyl-1,3-oxathiolane-2-thione is S=C1OCC(c2ccccc2)S1.
What is the InChIKey of 4-phenyl-1,3-oxathiolane-2-thione?
The InChIKey is JTFNGUVZLCTGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OS2/c11-9-10-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 4-phenyl-1,3-oxathiolane-2-thione?
4-phenyl-1,3-oxathiolane-2-thione has a molecular weight of 196.30 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,3-oxathiolane-2-thione is sourced from PubChem (CID 10375443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).