C13H18BrN3O3S — CID 103754452
(2-bromo-4-pyridinyl)-(4-propylsulfonylpiperazin-1-yl)methanone (PubChem CID 103754452) has the molecular formula C13H18BrN3O3S and a molecular weight of 376.28 g/mol. Its IUPAC name is (2-bromo-4-pyridinyl)-(4-propylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2-bromo-4-pyridinyl)-(4-propylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 103754452 |
| Molecular Formula | C13H18BrN3O3S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | (2-bromo-4-pyridinyl)-(4-propylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)c2ccnc(Br)c2)CC1 |
| InChI | InChI=1S/C13H18BrN3O3S/c1-2-9-21(19,20)17-7-5-16(6-8-17)13(18)11-3-4-15-12(14)10-11/h3-4,10H,2,5-9H2,1H3 |
| InChIKey | XEZCZLUBEVCDEO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|