C10H11BrN2O3S — CID 103755134
(2-bromo-4-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 103755134) has the molecular formula C10H11BrN2O3S and a molecular weight of 319.18 g/mol. Its IUPAC name is (2-bromo-4-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2-bromo-4-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 103755134 |
| Molecular Formula | C10H11BrN2O3S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | (2-bromo-4-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccnc(Br)c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H11BrN2O3S/c11-9-7-8(1-2-12-9)10(14)13-3-5-17(15,16)6-4-13/h1-2,7H,3-6H2 |
| InChIKey | LDBJWPLTSZXQCF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|