C14H14N2O5 — CID 103756130
2-[(7-methoxyisoquinolin-1-yl)amino]butanedioic acid (PubChem CID 103756130) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(7-methoxyisoquinolin-1-yl)amino]butanedioic acid.
| Compound Name | 2-[(7-methoxyisoquinolin-1-yl)amino]butanedioic acid |
|---|---|
| PubChem CID | 103756130 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[(7-methoxyisoquinolin-1-yl)amino]butanedioic acid |
| SMILES | COc1ccc2ccnc(NC(CC(=O)O)C(=O)O)c2c1 |
| InChI | InChI=1S/C14H14N2O5/c1-21-9-3-2-8-4-5-15-13(10(8)6-9)16-11(14(19)20)7-12(17)18/h2-6,11H,7H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | RTQCPIHHUDSPPD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |