C16H20N2O3 — CID 106535969
2-[(7-methoxyisoquinolin-1-yl)amino]-2-methylpentanoic acid (PubChem CID 106535969) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(7-methoxyisoquinolin-1-yl)amino]-2-methylpentanoic acid.
| Compound Name | 2-[(7-methoxyisoquinolin-1-yl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 106535969 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(7-methoxyisoquinolin-1-yl)amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(Nc1nccc2ccc(OC)cc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-4-8-16(2,15(19)20)18-14-13-10-12(21-3)6-5-11(13)7-9-17-14/h5-7,9-10H,4,8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | SNBUFHPONGXFFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |