C11H17ClN2 — CID 103756761
2-chloro-N-(2,2-dimethylpropyl)-N-methylpyridin-4-amine (PubChem CID 103756761) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylpropyl)-N-methylpyridin-4-amine.
| Compound Name | 2-chloro-N-(2,2-dimethylpropyl)-N-methylpyridin-4-amine |
|---|---|
| PubChem CID | 103756761 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylpropyl)-N-methylpyridin-4-amine |
| SMILES | CN(CC(C)(C)C)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2/c1-11(2,3)8-14(4)9-5-6-13-10(12)7-9/h5-7H,8H2,1-4H3 |
| InChIKey | HTHHHZUPXVFRPI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|