C10H16ClN3 — CID 103757162
N'-(2-chloro-4-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 103757162) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is N'-(2-chloro-4-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(2-chloro-4-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103757162 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N'-(2-chloro-4-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H16ClN3/c1-13(2)6-7-14(3)9-4-5-12-10(11)8-9/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | WQVOBTYSGBLMQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|