C10H12ClN3 — CID 10375812
(1S,5S)-3-(6-chloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 10375812) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is (1S,5S)-3-(6-chloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | (1S,5S)-3-(6-chloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 10375812 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (1S,5S)-3-(6-chloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | Clc1ccc(N2C[C@@H]3CN[C@@H]3C2)cn1 |
| InChI | InChI=1S/C10H12ClN3/c11-10-2-1-8(4-13-10)14-5-7-3-12-9(7)6-14/h1-2,4,7,9,12H,3,5-6H2/t7-,9+/m0/s1 |
| InChIKey | ZUQWAAYYWZDXPL-IONNQARKSA-N |
| XLogP | 1.14 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|