C12H22O3 — CID 10375956
2-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol (PubChem CID 10375956) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol.
| Compound Name | 2-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 10375956 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol |
| SMILES | C=CCC[C@@H]1OC(C)(C)O[C@H]1C(C)(C)O |
| InChI | InChI=1S/C12H22O3/c1-6-7-8-9-10(11(2,3)13)15-12(4,5)14-9/h6,9-10,13H,1,7-8H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | LJXIXSVTVCOLEZ-VHSXEESVSA-N |
| XLogP | 2.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|