C17H32N2O3 — CID 103759643
tert-butyl N-[3-(2-cyclohexyloxyethylamino)cyclobutyl]carbamate (PubChem CID 103759643) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is tert-butyl N-[3-(2-cyclohexyloxyethylamino)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-cyclohexyloxyethylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103759643 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | tert-butyl N-[3-(2-cyclohexyloxyethylamino)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NCCOC2CCCCC2)C1 |
| InChI | InChI=1S/C17H32N2O3/c1-17(2,3)22-16(20)19-14-11-13(12-14)18-9-10-21-15-7-5-4-6-8-15/h13-15,18H,4-12H2,1-3H3,(H,19,20) |
| InChIKey | AKURFKRIUIHHKS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|