C17H33N3O3 — CID 107252500
tert-butyl N-[4-[3-(azetidin-3-ylamino)propoxy]cyclohexyl]carbamate (PubChem CID 107252500) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(azetidin-3-ylamino)propoxy]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(azetidin-3-ylamino)propoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 107252500 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | tert-butyl N-[4-[3-(azetidin-3-ylamino)propoxy]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(OCCCNC2CNC2)CC1 |
| InChI | InChI=1S/C17H33N3O3/c1-17(2,3)23-16(21)20-13-5-7-15(8-6-13)22-10-4-9-19-14-11-18-12-14/h13-15,18-19H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | PYVSBNPBOCAWOM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|