C14H28N2O3 — CID 79113499
tert-butyl N-[4-(3-hydroxypropylamino)cyclohexyl]carbamate (PubChem CID 79113499) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is tert-butyl N-[4-(3-hydroxypropylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-hydroxypropylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 79113499 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | tert-butyl N-[4-(3-hydroxypropylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCCCO)CC1 |
| InChI | InChI=1S/C14H28N2O3/c1-14(2,3)19-13(18)16-12-7-5-11(6-8-12)15-9-4-10-17/h11-12,15,17H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | KLBWQXJIWUXAPD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|