C14H28N2O3S — CID 106309457
tert-butyl N-[3-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclobutyl]carbamate (PubChem CID 106309457) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 106309457 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[3-[2-(3-hydroxypropylsulfanyl)ethylamino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NCCSCCCO)C1 |
| InChI | InChI=1S/C14H28N2O3S/c1-14(2,3)19-13(18)16-12-9-11(10-12)15-5-8-20-7-4-6-17/h11-12,15,17H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | VCGUVCZZGCTBKA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|