C13H26N2O3S — CID 102672027
tert-butyl 3-[2-(3-hydroxypropylsulfanyl)ethylamino]azetidine-1-carboxylate (PubChem CID 102672027) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-hydroxypropylsulfanyl)ethylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-hydroxypropylsulfanyl)ethylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 102672027 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl 3-[2-(3-hydroxypropylsulfanyl)ethylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCCSCCCO)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-13(2,3)18-12(17)15-9-11(10-15)14-5-8-19-7-4-6-16/h11,14,16H,4-10H2,1-3H3 |
| InChIKey | SMGPHSZVFARDFU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|