C11H23N3O4S — CID 63302897
tert-butyl 3-(3-sulfamoylpropylamino)azetidine-1-carboxylate (PubChem CID 63302897) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is tert-butyl 3-(3-sulfamoylpropylamino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-sulfamoylpropylamino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63302897 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl 3-(3-sulfamoylpropylamino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCCCS(N)(=O)=O)C1 |
| InChI | InChI=1S/C11H23N3O4S/c1-11(2,3)18-10(15)14-7-9(8-14)13-5-4-6-19(12,16)17/h9,13H,4-8H2,1-3H3,(H2,12,16,17) |
| InChIKey | OWKDRVYPSRIHAN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|