C17H32N2O2S — CID 103759699
tert-butyl 3-[(thian-2-ylmethylamino)methyl]piperidine-1-carboxylate (PubChem CID 103759699) has the molecular formula C17H32N2O2S and a molecular weight of 328.52 g/mol. Its IUPAC name is tert-butyl 3-[(thian-2-ylmethylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(thian-2-ylmethylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103759699 |
| Molecular Formula | C17H32N2O2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl 3-[(thian-2-ylmethylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNCC2CCCCS2)C1 |
| InChI | InChI=1S/C17H32N2O2S/c1-17(2,3)21-16(20)19-9-6-7-14(13-19)11-18-12-15-8-4-5-10-22-15/h14-15,18H,4-13H2,1-3H3 |
| InChIKey | QAKBXMMNYAWWMS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |