C10H12BrF2N — CID 103759748
3-(3-bromophenyl)-1,1-difluoro-N-methylpropan-2-amine (PubChem CID 103759748) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,1-difluoro-N-methylpropan-2-amine.
| Compound Name | 3-(3-bromophenyl)-1,1-difluoro-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 103759748 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3-(3-bromophenyl)-1,1-difluoro-N-methylpropan-2-amine |
| SMILES | CNC(Cc1cccc(Br)c1)C(F)F |
| InChI | InChI=1S/C10H12BrF2N/c1-14-9(10(12)13)6-7-3-2-4-8(11)5-7/h2-5,9-10,14H,6H2,1H3 |
| InChIKey | OKBFZBCOABBPTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |