C16H26BrN — CID 63528117
1-(3-bromophenyl)-3-ethyl-N-methylheptan-2-amine (PubChem CID 63528117) has the molecular formula C16H26BrN and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-ethyl-N-methylheptan-2-amine.
| Compound Name | 1-(3-bromophenyl)-3-ethyl-N-methylheptan-2-amine |
|---|---|
| PubChem CID | 63528117 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(3-bromophenyl)-3-ethyl-N-methylheptan-2-amine |
| SMILES | CCCCC(CC)C(Cc1cccc(Br)c1)NC |
| InChI | InChI=1S/C16H26BrN/c1-4-6-9-14(5-2)16(18-3)12-13-8-7-10-15(17)11-13/h7-8,10-11,14,16,18H,4-6,9,12H2,1-3H3 |
| InChIKey | URHBNNDKZCKPTE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |