C11H14FN3O — CID 103760464
5-fluoro-6-methyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrimidin-4-amine (PubChem CID 103760464) has the molecular formula C11H14FN3O and a molecular weight of 223.25 g/mol. Its IUPAC name is 5-fluoro-6-methyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrimidin-4-amine.
| Compound Name | 5-fluoro-6-methyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103760464 |
| Molecular Formula | C11H14FN3O |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-fluoro-6-methyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrimidin-4-amine |
| SMILES | Cc1ncnc(NC2CC3CCC2O3)c1F |
| InChI | InChI=1S/C11H14FN3O/c1-6-10(12)11(14-5-13-6)15-8-4-7-2-3-9(8)16-7/h5,7-9H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | ONMFOINGHQHZFH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |