C16H22N4O2 — CID 129429968
4-N,6-N-bis[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]pyrimidine-4,6-diamine (PubChem CID 129429968) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-N,6-N-bis[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 129429968 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-N,6-N-bis[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]pyrimidine-4,6-diamine |
| SMILES | c1nc(N[C@H]2C[C@H]3CC[C@H]2O3)cc(N[C@H]2C[C@H]3CC[C@H]2O3)n1 |
| InChI | InChI=1S/C16H22N4O2/c1-3-13-11(5-9(1)21-13)19-15-7-16(18-8-17-15)20-12-6-10-2-4-14(12)22-10/h7-14H,1-6H2,(H2,17,18,19,20)/t9-,10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | REYVTHJIPMOLLX-UYYXNEDZSA-N |
| XLogP | 1.94 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |