About N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide
N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 103761827) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| PubChem CID | 103761827 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C14H19NO/c1-4-14(2,3)15-13(16)12-10-8-5-6-9(7-8)11(10)12/h1,8-12H,5-7H2,2-3H3,(H,15,16) |
| InChIKey | RFMDEZJGBSYSKV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The IUPAC name of N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide (CID 103761827) is N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
What is the SMILES notation for N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The canonical SMILES for N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide is C#CC(C)(C)NC(=O)C1C2C3CCC(C3)C12.
What is the InChIKey of N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The InChIKey is RFMDEZJGBSYSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-4-14(2,3)15-13(16)12-10-8-5-6-9(7-8)11(10)12/h1,8-12H,5-7H2,2-3H3,(H,15,16).
What are the key properties of N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide has a molecular weight of 217.31 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylbut-3-yn-2-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide is sourced from PubChem (CID 103761827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).