C12H17N3O2 — CID 103763244
4-(4-methyl-1,4-diazepane-1-carbonyl)-1H-pyridin-2-one (PubChem CID 103763244) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepane-1-carbonyl)-1H-pyridin-2-one.
| Compound Name | 4-(4-methyl-1,4-diazepane-1-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 103763244 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-(4-methyl-1,4-diazepane-1-carbonyl)-1H-pyridin-2-one |
| SMILES | CN1CCCN(C(=O)c2cc[nH]c(=O)c2)CC1 |
| InChI | InChI=1S/C12H17N3O2/c1-14-5-2-6-15(8-7-14)12(17)10-3-4-13-11(16)9-10/h3-4,9H,2,5-8H2,1H3,(H,13,16) |
| InChIKey | DBTDZRNTAYLFJK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |