C13H24OSi — CID 10376355
trimethyl-[(1E)-2-[(2R)-oxan-2-yl]penta-1,4-dienyl]silane (PubChem CID 10376355) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is trimethyl-[(1E)-2-[(2R)-oxan-2-yl]penta-1,4-dienyl]silane.
| Compound Name | trimethyl-[(1E)-2-[(2R)-oxan-2-yl]penta-1,4-dienyl]silane |
|---|---|
| PubChem CID | 10376355 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | trimethyl-[(1E)-2-[(2R)-oxan-2-yl]penta-1,4-dienyl]silane |
| SMILES | C=CC/C(=C\[Si](C)(C)C)[C@H]1CCCCO1 |
| InChI | InChI=1S/C13H24OSi/c1-5-8-12(11-15(2,3)4)13-9-6-7-10-14-13/h5,11,13H,1,6-10H2,2-4H3/b12-11+/t13-/m1/s1 |
| InChIKey | QFGFIFLGRNBAGD-XZHRJIJLSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|