C15H20BrClN2O2 — CID 103763940
2-bromo-4-chloro-N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 103763940) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-bromo-4-chloro-N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 103763940 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-bromo-4-chloro-N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1Br)C(=O)N(C)C |
| InChI | InChI=1S/C15H20BrClN2O2/c1-9(2)7-13(15(21)19(3)4)18-14(20)11-6-5-10(17)8-12(11)16/h5-6,8-9,13H,7H2,1-4H3,(H,18,20) |
| InChIKey | IWTRXRLQGWGMPQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |