C8H8F2N2O2 — CID 103766094
N-(2,2-difluoroethyl)-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 103766094) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103766094 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCC(F)F)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C8H8F2N2O2/c9-6(10)4-12-8(14)5-1-2-11-7(13)3-5/h1-3,6H,4H2,(H,11,13)(H,12,14) |
| InChIKey | KKIBDNZWOGNCCE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |